CymitQuimica logo

CAS 319472-78-1

:

3,6-diiodo-1H-indazole

Description:
3,6-Diiodo-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of two iodine atoms at the 3 and 6 positions of the indazole structure significantly influences its chemical properties, including its reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential use in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The iodine substituents can enhance the lipophilicity of the molecule, potentially improving its ability to penetrate biological membranes. Additionally, 3,6-diiodo-1H-indazole may exhibit interesting electronic properties, making it a candidate for various applications in organic electronics and materials science. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental impact.
Formula:C7H4I2N2
InChI:InChI=1/C7H4I2N2/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H,10,11)
InChI key:XHVJIWVECAQYNF-UHFFFAOYSA-N
SMILES:c1cc2c(cc1I)[nH]nc2I
Found 7 products.