CAS 31972-52-8
:Boc-Gly-Gly-OH
Description:
Boc-Gly-Gly-OH, also known as N-Boc-glycylglycine, is a dipeptide derivative characterized by the presence of two glycine residues and a tert-butyloxycarbonyl (Boc) protecting group on the amino terminus. This compound is commonly used in peptide synthesis and as a building block in organic chemistry due to its stability and ease of manipulation. The Boc group serves to protect the amine functionality during chemical reactions, allowing for selective modifications. Boc-Gly-Gly-OH is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. Its molecular structure contributes to its relatively low toxicity, making it suitable for various applications in biochemical research and pharmaceutical development. Additionally, the compound can undergo hydrolysis to release the free amino acids, which can be useful in studying peptide behavior and interactions. Overall, Boc-Gly-Gly-OH is a valuable compound in the field of peptide chemistry, facilitating the synthesis of more complex peptide structures.
Formula:C9H16N2O5
InChI:InChI=1/C9H16N2O5/c1-9(2,3)16-8(15)11-4-6(12)10-5-7(13)14/h4-5H2,1-3H3,(H,10,12)(H,11,15)(H,13,14)
SMILES:CC(C)(C)OC(=NCC(=NCC(=O)O)O)O
Synonyms:- N-(tert-butoxycarbonyl)glycylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-(tert-Butoxycarbonyl)glycylglycine
CAS:Formula:C9H16N2O5Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:232.24N-Boc-glycylglycine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H16N2O5Purity:97%Molecular weight:232.24Boc-Gly-Gly-OH
CAS:Bachem ID: 4000223.
Formula:C9H16N2O5Purity:> 99%Color and Shape:WhiteMolecular weight:232.24N-(tert-Butoxycarbonyl)glycylglycine
CAS:Formula:C9H16N2O5Purity:95%Color and Shape:SolidMolecular weight:232.2337Boc-Gly-Gly-OH
CAS:Boc-Gly-Gly-OH is a synthetic molecule with inhibitory properties. It has been shown to prevent the polymerization of tubulin into microtubules by binding to the hydroxyl group on lysine residues in the monomeric form. Boc-Gly-Gly-OH can be used as a reagent in organic solution, and can be seen under an electron microscope as nanodots.Formula:C9H16N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:232.23 g/molN-(2-N-Boc-Amino-acetyl)-glycine
CAS:Formula:C9H16N2O5Purity:97%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:232.236







