CymitQuimica logo

CAS 31972-52-8

:

Boc-Gly-Gly-OH

Description:
Boc-Gly-Gly-OH, also known as N-Boc-glycylglycine, is a dipeptide derivative characterized by the presence of two glycine residues and a tert-butyloxycarbonyl (Boc) protecting group on the amino terminus. This compound is commonly used in peptide synthesis and as a building block in organic chemistry due to its stability and ease of manipulation. The Boc group serves to protect the amine functionality during chemical reactions, allowing for selective modifications. Boc-Gly-Gly-OH is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. Its molecular structure contributes to its relatively low toxicity, making it suitable for various applications in biochemical research and pharmaceutical development. Additionally, the compound can undergo hydrolysis to release the free amino acids, which can be useful in studying peptide behavior and interactions. Overall, Boc-Gly-Gly-OH is a valuable compound in the field of peptide chemistry, facilitating the synthesis of more complex peptide structures.
Formula:C9H16N2O5
InChI:InChI=1/C9H16N2O5/c1-9(2,3)16-8(15)11-4-6(12)10-5-7(13)14/h4-5H2,1-3H3,(H,10,12)(H,11,15)(H,13,14)
InChI key:HWBAHOVOSOAFLE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCC(=NCC(=O)O)O)O
Synonyms:
  • N-(tert-butoxycarbonyl)glycylglycine
Found 8 products.