CymitQuimica logo

CAS 320-55-8

:

1,4-Dichloro-2,5-bis(trifluoromethyl)benzene

Description:
1,4-Dichloro-2,5-bis(trifluoromethyl)benzene, with the CAS number 320-55-8, is an aromatic compound characterized by the presence of two chlorine atoms and two trifluoromethyl groups attached to a benzene ring. This compound exhibits a high degree of fluorination, which contributes to its chemical stability and hydrophobic properties. It is typically a colorless to pale yellow solid at room temperature and has a relatively high melting point. The presence of the trifluoromethyl groups enhances its lipophilicity and can influence its reactivity, making it useful in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. Additionally, the chlorinated structure may impart certain biological activities, although specific toxicity and environmental impact assessments are necessary for comprehensive understanding. Due to its unique properties, this compound is of interest in materials science and organic synthesis, but handling should be done with caution due to potential health and environmental risks associated with halogenated compounds.
Formula:C8H2Cl2F6
InChI:InChI=1S/C8H2Cl2F6/c9-5-1-3(7(11,12)13)6(10)2-4(5)8(14,15)16/h1-2H
InChI key:InChIKey=DENJDJUSVAFAOJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C=C(C(F)(F)F)C(Cl)=C1
Synonyms:
  • p-Xylene, 2,5-dichloro-α,α,α,α′,α′,α′-hexafluoro-
  • 1,4-Dichloro-2,5-bis(trifluoromethyl)benzene
  • Benzene, 1,4-dichloro-2,5-bis(trifluoromethyl)-
Found 2 products.