CymitQuimica logo

CAS 320-75-2

:

2-Bromo-4-fluoro-6-nitrophenol

Description:
2-Bromo-4-fluoro-6-nitrophenol is an organic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a phenolic ring. Its molecular structure features a hydroxyl group (-OH) that contributes to its acidic properties, making it a weak acid. The compound is typically a solid at room temperature and is known for its yellow to orange coloration. It is soluble in organic solvents but has limited solubility in water due to the hydrophobic nature of the aromatic ring. The presence of the nitro group enhances its electron-withdrawing characteristics, which can influence its reactivity and stability. 2-Bromo-4-fluoro-6-nitrophenol is often used in various chemical syntheses and as an intermediate in the production of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C6H3BrFNO3
InChI:InChI=1S/C6H3BrFNO3/c7-4-1-3(8)2-5(6(4)10)9(11)12/h1-2,10H
InChI key:InChIKey=DFHGOCSWFGXYSQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)C(Br)=CC(F)=C1
Synonyms:
  • 6-Bromo-4-fluoro-2-nitrophenol
  • Phenol, 2-bromo-4-fluoro-6-nitro-
  • 2-Bromo-4-fluoro-6-nitrophenol
Found 4 products.