CymitQuimica logo

CAS 32017-77-9

:

2-(3-Methoxyphenyl)oxirane

Description:
2-(3-Methoxyphenyl)oxirane, also known as a methoxy-substituted epoxide, is an organic compound characterized by the presence of an epoxide functional group, which consists of a three-membered cyclic ether. The compound features a methoxy group (-OCH₃) attached to a phenyl ring, specifically at the meta position relative to the epoxide. This structure imparts unique reactivity and properties, making it a valuable intermediate in organic synthesis. The epoxide group is known for its strain and reactivity, allowing it to undergo ring-opening reactions in the presence of nucleophiles, which can lead to the formation of various derivatives. The methoxy group can influence the compound's solubility, polarity, and overall reactivity. Additionally, 2-(3-Methoxyphenyl)oxirane may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and the presence of substituents. Overall, this compound serves as an important building block in the synthesis of more complex organic molecules.
Formula:C9H10O2
InChI:InChI=1S/C9H10O2/c1-10-8-4-2-3-7(5-8)9-6-11-9/h2-5,9H,6H2,1H3
InChI key:InChIKey=IJUUWUSPXYGGKY-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C2CO2)C=CC1
Synonyms:
  • (3-Methoxyphenyl)oxirane
  • 2-(m-Methoxyphenyl)oxirane
  • 3-Methoxystyrene oxide
  • Anisole, m-(epoxyethyl)-
  • Benzene, 1-(epoxyethyl)-3-methoxy-
  • NSC 55876
  • Oxirane, (3-methoxyphenyl)-
  • Oxirane, 2-(3-methoxyphenyl)-
  • m-Methoxystyrene oxide
  • 2-(3-Methoxyphenyl)oxirane
Found 3 products.