CAS 32018-86-3
:1-Naphthalenecarboxylic acid, 3-amino-
Description:
1-Naphthalenecarboxylic acid, 3-amino- is an organic compound characterized by the presence of both a carboxylic acid group and an amino group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with a stable aromatic structure. The carboxylic acid group (-COOH) contributes to its acidic properties, while the amino group (-NH2) imparts basic characteristics, allowing for potential interactions in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the functional groups. It can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. 1-Naphthalenecarboxylic acid, 3-amino- is of interest in various fields, including pharmaceuticals and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. Its unique structure and functional groups make it a valuable compound for research and application in chemical processes.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c12-8-5-7-3-1-2-4-9(7)10(6-8)11(13)14/h1-6H,12H2,(H,13,14)
InChI key:YIPRQTYMJYGRER-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=C(C=C2C(=O)O)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Aminonaphthalene-1-carboxylic Acid
CAS:Controlled ProductFormula:C11H9NO2Color and Shape:NeatMolecular weight:187.1953-Aminonaphthalene-1-carboxylic acid
CAS:3-Aminonaphthalene-1-carboxylic acid is a pyridine derivative that is structurally similar to the sulfoxide and dimethyl sulfoxide. The linear regression of the methanol and acetonitrile solvates was found to be dependent on substituent effects. The model compounds, naphthalene and benzene, were used as substituents in this experiment. Substituent effects are seen in the form of steric hindrance, inductive effect, and resonance stabilization. 3-Aminonaphthalene-1-carboxylic acid has been shown to have a variety of uses, including use as an intermediate in the synthesis of model compound skeletons.
Formula:C11H9NO2Purity:Min. 95%Molecular weight:187.19 g/mol


