CymitQuimica logo

CAS 32058-82-5

:

5-(4-aminophenyl)-1,3,4-oxadiazole-2(3H)-thione

Description:
5-(4-Aminophenyl)-1,3,4-oxadiazole-2(3H)-thione, with the CAS number 32058-82-5, is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the oxadiazole structure. The amino group attached to the phenyl ring enhances its potential for various chemical reactions and biological activities. Typically, compounds of this nature exhibit interesting pharmacological properties, including antimicrobial and anticancer activities, due to their ability to interact with biological targets. The presence of both nitrogen and sulfur in its structure may contribute to its reactivity and solubility in various solvents. Additionally, the compound's stability and behavior under different conditions can be influenced by the substituents on the aromatic ring and the overall electronic distribution within the molecule.
Formula:C8H7N3OS
InChI:InChI=1/C8H7N3OS/c9-6-3-1-5(2-4-6)7-10-11-8(13)12-7/h1-4H,9H2,(H,11,13)
InChI key:FIGMOSDEYMCQLX-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1nnc(o1)S)N
Synonyms:
  • 1,3,4-Oxadiazole-2-Thiol, 5-(4-Aminophenyl)-
  • 5-(4-Aminophenyl)-1,3,4-oxadiazole-2-thiol
Found 5 products.