CAS 32122-09-1
:ethyl (benzyloxy)acetate
Description:
Ethyl (benzyloxy)acetate, with the CAS number 32122-09-1, is an organic compound characterized by its ester functional group. It is formed from the reaction of ethyl acetate and benzyl alcohol, resulting in a structure that includes both an ethyl group and a benzyloxy moiety. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor, making it useful in flavor and fragrance applications. Ethyl (benzyloxy)acetate is moderately soluble in water and more soluble in organic solvents, reflecting its dual hydrophobic and hydrophilic characteristics. Its boiling point and density are consistent with those of similar esters, and it is generally stable under standard conditions. However, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Additionally, it can undergo hydrolysis in the presence of water, leading to the formation of the corresponding alcohol and acid. Overall, ethyl (benzyloxy)acetate is valued for its aromatic properties and versatility in various chemical applications.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-2-14-11(12)9-13-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3
SMILES:CCOC(=O)COCc1ccccc1
Synonyms:- 2Ov1O1R
- 32122-09-1
- Acetic acid, (phenylmethoxy)-, ethyl ester
- 2-O-Benzylglycolic Acid Ethyl Ester
- Ethyl (benzyloxy)acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 2-(benzyloxy)acetate
CAS:Formula:C11H14O3Purity:98%Color and Shape:LiquidMolecular weight:194.2271Ethyl 2-(benzyloxy)acetate
CAS:Ethyl 2-(benzyloxy)acetateFormula:C11H14O3Purity:>99%Molecular weight:194.23Ethyl (Benzyloxy)acetate
CAS:Formula:C11H14O3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:194.23Ethyl 2-(benzyloxy)acetate
CAS:Ethyl 2-(benzyloxy)acetateFormula:C11H14O3Purity:97%Molecular weight:194.23Ethyl 2-(benzyloxy)acetate
CAS:Formula:C11H14O3Purity:95%Color and Shape:LiquidMolecular weight:194.23Ethyl (Benzyloxy)acetate
CAS:Ethyl (Benzyloxy)acetate is a β-unsaturated ketone that is used in the synthesis of peroxisome proliferators. It is also used in the asymmetric synthesis of β-unsaturated ketones. Ethyl (Benzyloxy)acetate has been shown to induce inflammation and inhibit serine protease, which may be due to its ability to bind to hydroxyl groups and heterocycles. It can also act as an anti-HIV agent by binding to the hydroxyl group of insulin, which causes insulin resistance. This compound is also used as a solvent for organic chemistry reactions, including the conversion of ethyl formate into acetic acid.Formula:C11H14O3Purity:Min. 95%Molecular weight:194.23 g/mol





