CymitQuimica logo

CAS 3213-91-0

:

1H-1,2,4-Triazole, 3-methyl-5-phenyl-

Description:
1H-1,2,4-Triazole, 3-methyl-5-phenyl- (CAS 3213-91-0) is a heterocyclic organic compound characterized by its triazole ring structure, which consists of three nitrogen atoms and two carbon atoms in a five-membered ring. This compound features a methyl group at the 3-position and a phenyl group at the 5-position of the triazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the triazole moiety imparts notable biological activity, making it of interest in pharmaceutical applications, particularly as a potential antifungal or antimicrobial agent. Additionally, the compound may exhibit interesting coordination chemistry due to the nitrogen atoms, which can act as ligands in metal complexes. Its stability and reactivity can be influenced by the substituents on the triazole ring, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c1-7-10-9(12-11-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,10,11,12)
InChI key:UJCLXNPHJKRLPX-UHFFFAOYSA-N
SMILES:CC1=NC(=NN1)C2=CC=CC=C2
Found 4 products.