CymitQuimica logo

CAS 321309-28-8

:

6-Fluoro-4H-1,3-benzodioxin-8-carboxylic acid

Description:
6-Fluoro-4H-1,3-benzodioxin-8-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzodioxin core with a carboxylic acid functional group and a fluorine substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The fluorine atom can influence the compound's polarity, solubility, and biological activity, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. Additionally, the presence of the dioxin moiety may impart unique electronic properties, which could be exploited in various chemical reactions or as a precursor in synthetic pathways. As with many fluorinated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of persistence and bioaccumulation. Overall, 6-Fluoro-4H-1,3-benzodioxin-8-carboxylic acid represents a compound of interest for further research and application in various fields.
Formula:C9H7FO4
InChI:InChI=1S/C9H7FO4/c10-6-1-5-3-13-4-14-8(5)7(2-6)9(11)12/h1-2H,3-4H2,(H,11,12)
InChI key:InChIKey=HWBALMSPYAUMMB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(F)=C1)COCO2
Synonyms:
  • 4H-1,3-Benzodioxin-8-carboxylic acid, 6-fluoro-
  • 6-Fluoro-1,3-benzodioxene-8-carboxylic acid
  • 6-Fluoro-4H-1,3-benzodioxin-8-carboxylic acid
  • 6-Fluoro-4H-benzo[1,3]dioxin-8-carboxylic acid
  • 6-Fluoro-4H-benzo[1,3]dioxine-8-carboxylic acid
Found 3 products.