CymitQuimica logo

CAS 32137-20-5

:

4-Chloro-3-fluorobenzotrifluoride

Description:
4-Chloro-3-fluorobenzotrifluoride, with the CAS number 32137-20-5, is an aromatic compound characterized by the presence of a benzene ring substituted with three fluorine atoms, a chlorine atom, and a trifluoromethyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively high stability and low volatility. It exhibits properties such as being non-polar and having a low solubility in water, making it more soluble in organic solvents. The presence of halogen substituents contributes to its reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, 4-Chloro-3-fluorobenzotrifluoride is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in materials science. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate precautions should be taken to minimize exposure.
Formula:C7H3ClF4
InChI:InChI=1S/C7H3ClF4/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H
InChI key:HKBWIKAFHCGRTH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)F)Cl
Found 6 products.