CymitQuimica logo

CAS 32140-46-8

:

alpha-glutamyltyrosylglutamic acid

Description:
Alpha-glutamyltyrosylglutamic acid, identified by its CAS number 32140-46-8, is a peptide composed of amino acids, specifically glutamic acid and tyrosine. This compound is characterized by its structure, which includes a sequence of these amino acids linked by peptide bonds. It exhibits properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of functional groups like carboxyl and amino groups. The presence of tyrosine contributes to its potential for UV absorbance, while the glutamic acid residues may influence its interaction with biological systems, including potential roles in neurotransmission or metabolic pathways. Additionally, this peptide may exhibit specific biological activities, such as antioxidant properties or involvement in cellular signaling. Its stability, reactivity, and biological functions can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment. Overall, alpha-glutamyltyrosylglutamic acid represents a unique combination of amino acids with potential applications in biochemistry and pharmacology.
Formula:C19H25N3O9
InChI:InChI=1/C19H25N3O9/c20-12(5-7-15(24)25)17(28)22-14(9-10-1-3-11(23)4-2-10)18(29)21-13(19(30)31)6-8-16(26)27/h1-4,12-14,23H,5-9,20H2,(H,21,29)(H,22,28)(H,24,25)(H,26,27)(H,30,31)
InChI key:RXJFSLQVMGYQEL-IHRRRGAJSA-N
SMILES:c1cc(ccc1CC(C(=NC(CCC(=O)O)C(=O)O)O)N=C(C(CCC(=O)O)N)O)O
Synonyms:
  • Glu-Tyr-Glu
  • H-Glu-Tyr-Glu-OH
Found 3 products.