CymitQuimica logo

CAS 321535-23-3

:

6-Iodo-2,3-dimethoxypyridine

Description:
6-Iodo-2,3-dimethoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with iodine and methoxy groups. The molecular structure features a pyridine core, which is a six-membered aromatic ring containing one nitrogen atom. The iodine atom is located at the 6-position, while two methoxy groups (-OCH3) are attached at the 2 and 3 positions of the ring. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. Its unique substitution pattern contributes to its potential reactivity and applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the iodine atom can enhance the compound's biological activity and lipophilicity, while the methoxy groups may influence its electronic properties and steric hindrance. As with many pyridine derivatives, 6-Iodo-2,3-dimethoxypyridine may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it a subject of interest in various chemical research fields.
Formula:C7H8INO2
InChI:InChI=1S/C7H8INO2/c1-10-5-3-4-6(8)9-7(5)11-2/h3-4H,1-2H3
InChI key:FTFRZLORDYKKMJ-UHFFFAOYSA-N
SMILES:COc1ccc(I)nc1OC
Synonyms:
  • 2,3-Dimethoxy-6-Iodopyridine
Found 4 products.