CAS 3217-47-8

2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde

Description:

2,3,5,6-Tetrafluorobenzene-1,4-dicarbaldehyde, with the CAS number 3217-47-8, is a fluorinated aromatic compound characterized by the presence of four fluorine atoms and two aldehyde functional groups attached to a benzene ring. The fluorine substituents significantly influence the compound's chemical properties, enhancing its reactivity and polarity compared to non-fluorinated analogs. This compound is typically a solid at room temperature and exhibits a high melting point due to the strong intermolecular forces associated with the fluorine atoms. Its aldehyde groups make it a versatile intermediate in organic synthesis, allowing for further functionalization and incorporation into more complex molecular architectures. Additionally, the presence of fluorine can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety considerations should be taken into account when handling this compound, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde is a valuable compound in various chemical applications.

Formula: C₈H₂F₄O₂

InChI: InChI=1/C8H2F4O2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h1-2H

SMILES: C(=O)c1c(c(c(C=O)c(c1F)F)F)F

Synonyms:

• 1,4-Benzenedicarboxaldehyde, 2,3,5,6-Tetrafluoro-
• 2,3,5,6-Tetrafluoroterephthalaldehyde

2,3,5,6-Tetrafluoroterephthalaldehyde

CAS: 3217-47-8

Formula: C₈H₂F₄O₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 206.10

Ref: 3B-T4088

Tetrafluoroterephthaldehyde

CAS: 3217-47-8

Formula: C₈H₂F₄O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.0939

Ref: IN-DA00366W

Tetrafluoroterephthalaldehyde

CAS: 3217-47-8

Tetrafluoroterephthalaldehyde

Purity: 99%

Molecular weight: 206.09g/mol

Ref: 54-PC408138

2,3,5,6-Tetrafluoroterephthalaldehyde

CAS: 3217-47-8

Formula: C₈H₂F₄O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 206.096

Ref: 10-F544519

Tetrafluoroterephthaldehyde

CAS: 3217-47-8

Tetrafluoroterephthaldehyde (TFPA) is a reactive aldehyde that can be synthesized in the laboratory by the reaction of trifluoromethanesulfonic acid with an aromatic hydrocarbon or ester compound. TFPA has been used to study the synthesis of supramolecular assemblies and supramolecular chemistry. The radiation-induced formation of TFPA is a useful method for the synthesis of polymers, and the thermal expansion of TFPA is high enough to be used as a thermometer. TFPA has shown chemical stability in both acidic and alkaline media, as well as resistance to radiation and oxidation. TFPA also has a high boiling point, making it useful for desolvation during gas chromatography experiments.

Formula: C₈H₂F₄O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 206.09 g/mol

Ref: 3D-FT94675