CymitQuimica logo

CAS 3217-47-8

:

2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde

Description:
2,3,5,6-Tetrafluorobenzene-1,4-dicarbaldehyde, with the CAS number 3217-47-8, is a fluorinated aromatic compound characterized by the presence of four fluorine atoms and two aldehyde functional groups attached to a benzene ring. The fluorine substituents significantly influence the compound's chemical properties, enhancing its reactivity and polarity compared to non-fluorinated analogs. This compound is typically a solid at room temperature and exhibits a high melting point due to the strong intermolecular forces associated with the fluorine atoms. Its aldehyde groups make it a versatile intermediate in organic synthesis, allowing for further functionalization and incorporation into more complex molecular architectures. Additionally, the presence of fluorine can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety considerations should be taken into account when handling this compound, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde is a valuable compound in various chemical applications.
Formula:C8H2F4O2
InChI:InChI=1/C8H2F4O2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h1-2H
InChI key:WJHRAPYKYJKACM-UHFFFAOYSA-N
SMILES:C(=O)c1c(c(c(C=O)c(c1F)F)F)F
Synonyms:
  • 1,4-Benzenedicarboxaldehyde, 2,3,5,6-Tetrafluoro-
  • 2,3,5,6-Tetrafluoroterephthalaldehyde
Found 5 products.