CAS 3217-47-8
:2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde
Description:
2,3,5,6-Tetrafluorobenzene-1,4-dicarbaldehyde, with the CAS number 3217-47-8, is a fluorinated aromatic compound characterized by the presence of four fluorine atoms and two aldehyde functional groups attached to a benzene ring. The fluorine substituents significantly influence the compound's chemical properties, enhancing its reactivity and polarity compared to non-fluorinated analogs. This compound is typically a solid at room temperature and exhibits a high melting point due to the strong intermolecular forces associated with the fluorine atoms. Its aldehyde groups make it a versatile intermediate in organic synthesis, allowing for further functionalization and incorporation into more complex molecular architectures. Additionally, the presence of fluorine can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety considerations should be taken into account when handling this compound, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 2,3,5,6-tetrafluorobenzene-1,4-dicarbaldehyde is a valuable compound in various chemical applications.
Formula:C8H2F4O2
InChI:InChI=1/C8H2F4O2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h1-2H
SMILES:C(=O)c1c(c(c(C=O)c(c1F)F)F)F
Synonyms:- 1,4-Benzenedicarboxaldehyde, 2,3,5,6-Tetrafluoro-
- 2,3,5,6-Tetrafluoroterephthalaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3,5,6-Tetrafluoroterephthalaldehyde
CAS:Formula:C8H2F4O2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:206.10Tetrafluoroterephthalaldehyde
CAS:TetrafluoroterephthalaldehydeFormula:C8H2F4O2Purity:99%Molecular weight:206.09389Tetrafluoroterephthaldehyde
CAS:Formula:C8H2F4O2Purity:98%Color and Shape:SolidMolecular weight:206.0939Ref: IN-DA00366W
50gTo inquire100gTo inquire100mg25.00€250mg25.00€1g53.00€5g117.00€10g163.00€15g234.00€25g360.00€2,3,5,6-Tetrafluoroterephthalaldehyde
CAS:Formula:C8H2F4O2Purity:96%Color and Shape:SolidMolecular weight:206.096Tetrafluoroterephthaldehyde
CAS:Tetrafluoroterephthaldehyde (TFPA) is a reactive aldehyde that can be synthesized in the laboratory by the reaction of trifluoromethanesulfonic acid with an aromatic hydrocarbon or ester compound. TFPA has been used to study the synthesis of supramolecular assemblies and supramolecular chemistry. The radiation-induced formation of TFPA is a useful method for the synthesis of polymers, and the thermal expansion of TFPA is high enough to be used as a thermometer. TFPA has shown chemical stability in both acidic and alkaline media, as well as resistance to radiation and oxidation. TFPA also has a high boiling point, making it useful for desolvation during gas chromatography experiments.
Formula:C8H2F4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:206.09 g/mol




