CymitQuimica logo

CAS 321744-16-5

:

(1R,2R,4S)-N-BOC-1-Amino-2-hydroxycyclopentane-4-carboxylic acid methyl ester

Description:
(1R,2R,4S)-N-BOC-1-Amino-2-hydroxycyclopentane-4-carboxylic acid methyl ester is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,2R,4S) configuration. This compound features a cyclopentane ring with a hydroxyl group and an amino group, contributing to its potential as a building block in peptide synthesis and pharmaceutical applications. The presence of the tert-butyloxycarbonyl (BOC) protecting group on the amino functionality enhances its stability and solubility, making it suitable for various chemical reactions. The methyl ester group at the carboxylic acid position provides additional reactivity, allowing for further modifications. This compound is typically used in organic synthesis, particularly in the development of biologically active molecules. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex compounds. As with many chiral substances, it may exhibit specific biological activities, which can be explored in medicinal chemistry contexts.
Formula:C12H21NO5
InChI:InChI=1/C12H21NO5/c1-12(2,3)18-11(16)13-8-5-7(6-9(8)14)10(15)17-4/h7-9,14H,5-6H2,1-4H3,(H,13,16)/t7-,8+,9+/m0/s1
InChI key:SSATZBUCOTXXGA-DJLDLDEBSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C[C@H]1O)C(=O)OC
Synonyms:
  • Methyl (1S,3R,4R)-N-BOC-3-amino-4-hydroxycyclopentanecarboxylate
  • methyl (1S,3R,4R)-3-[(tert-butoxycarbonyl)amino]-4-hydroxycyclopentanecarboxylate
Found 3 products.