CAS 32178-63-5
:8-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
Description:
8-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, identified by its CAS number 32178-63-5, is an organic compound characterized by its naphthalene structure, which is a bicyclic aromatic hydrocarbon. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH) attached to the tetrahydronaphthalene framework. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. The carboxylic acid functionality contributes to its acidity and potential for forming salts or esters. This compound may exhibit interesting properties such as potential antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. Its structural characteristics suggest it could participate in various chemical reactions, including esterification and amidation. Additionally, the stereochemistry of the tetrahydronaphthalene ring can lead to different isomers, which may have distinct properties and biological activities. Overall, 8-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-15-11-4-2-3-8-5-6-9(12(13)14)7-10(8)11/h2-4,9H,5-7H2,1H3,(H,13,14)
SMILES:COc1cccc2CCC(Cc12)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
8-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H14O3Purity:98%Color and Shape:Crystals or powder or crystalline powder, Cream to pink to brownMolecular weight:206.248-Methoxy-1,2,3,4-Tetrahydronaphtalene-2-Carboxylic Acid
CAS:Formula:C12H14O3Purity:94%Color and Shape:SolidMolecular weight:206.2378

