CymitQuimica logo

CAS 321903-29-1

:

2,1-Benzoxasilole, 1,3-dihydro-1,1-dimethyl-

Description:
2,1-Benzoxasilole, 1,3-dihydro-1,1-dimethyl- is an organic compound characterized by its unique structure that combines elements of both benzene and silole, featuring a silicon atom in its ring system. This compound typically exhibits properties associated with heterocyclic compounds, including potential aromaticity due to the presence of the benzene ring. The dimethyl substitution suggests increased steric hindrance, which may influence its reactivity and stability. Generally, compounds of this nature can display interesting electronic properties, making them of interest in materials science and organic electronics. They may also possess unique photophysical characteristics, which can be exploited in applications such as light-emitting devices or sensors. Additionally, the presence of the silicon atom can impart distinctive chemical reactivity compared to purely carbon-based analogs. As with many organic compounds, the specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular environment and substituents present.
Formula:C9H12OSi
InChI:InChI=1S/C9H12OSi/c1-11(2)9-6-4-3-5-8(9)7-10-11/h3-6H,7H2,1-2H3
InChI key:GLZOQCBCUKBUJG-UHFFFAOYSA-N
SMILES:C[Si]1(C2=CC=CC=C2CO1)C
Found 3 products.