CAS 321983-19-1

1-tert-butoxycarbonyl-3-phenyl-piperidine-2-carboxylic acid

Description:

1-tert-butoxycarbonyl-3-phenyl-piperidine-2-carboxylic acid, identified by its CAS number 321983-19-1, is a chemical compound that features a piperidine ring substituted with a phenyl group and a tert-butoxycarbonyl (Boc) protecting group. This compound is characterized by its carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the Boc group indicates that it is likely used in organic synthesis, particularly in the protection of amines during multi-step reactions. The phenyl substitution enhances the compound's lipophilicity, potentially influencing its solubility and biological activity. Additionally, the piperidine structure is known for its role in medicinal chemistry, often serving as a scaffold for various pharmacologically active compounds. Overall, this compound's unique structural features make it a valuable intermediate in the synthesis of more complex molecules in pharmaceutical research and development.

Formula: C₁₇H₂₃NO₄

InChI: InChI=1/C17H23NO4/c1-17(2,3)22-16(21)18-11-7-10-13(14(18)15(19)20)12-8-5-4-6-9-12/h4-6,8-9,13-14H,7,10-11H2,1-3H3,(H,19,20)

InChI key: RJSXGIUXOYNBAE-UHFFFAOYSA-N

SMILES: CC(C)(C)OC(=O)N1CCCC(c2ccccc2)C1C(=O)O

Synonyms:

• 1-(tert-Butoxycarbonyl)-3-phenylpiperidine-2-carboxylic acid

3-Phenyl-piperidine-1,2-dicarboxylic acid 1-tert-butyl ester

CAS: 321983-19-1

Formula: C₁₇H₂₃NO₄

Molecular weight: 305.3688

Ref: IN-DA00BYVZ