CymitQuimica logo

CAS 32219-16-2

:

Benzenamine, 2-(1-naphthalenyloxy)-

Description:
Benzenamine, 2-(1-naphthalenyloxy)-, also known by its CAS number 32219-16-2, is an organic compound characterized by the presence of both an amine and an ether functional group. This compound features a naphthalene moiety linked to a benzenamine structure through an ether bond, which contributes to its unique chemical properties. It typically appears as a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the naphthalene ring imparts aromatic characteristics, which can influence its reactivity and stability. Benzenamine derivatives are often utilized in various applications, including as intermediates in the synthesis of dyes, pharmaceuticals, and agrochemicals. The compound may exhibit moderate to high solubility in organic solvents, while its solubility in water can vary. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as amines can be hazardous.
Formula:C16H13NO
InChI:InChI=1S/C16H13NO/c17-14-9-3-4-10-16(14)18-15-11-5-7-12-6-1-2-8-13(12)15/h1-11H,17H2
InChI key:XGFJMWKZGVEFBI-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=CC=C2OC3=CC=CC=C3N
Found 1 products.