CAS 3222-61-5

Formula: C7H13NO2

InChI: InChI=1S/C7H13NO2/c1-3-6(8)5-7(9)10-4-2/h5H,3-4,8H2,1-2H3/b6-5-

InChI key: ZRLNPHNIOXIZHR-WAYWQWQTSA-N

SMILES: CC/C(=C/C(=O)OCC)/N

Ethyl 3-aminopent-2-enoate

CAS: 3222-61-5

Ethyl 3-aminopent-2-enoate

Formula: C₇H₁₃NO₂

Purity: 95%

Molecular weight: 143.19

Ref: 54-OR1054065

ethyl 3-aminopent-2-enoate

CAS: 3222-61-5

Formula: C₇H₁₃NO₂

Purity: 95%

Molecular weight: 143.1836

Ref: IN-DA00CLYY

Ethyl 3-aminopent-2-enoate

CAS: 3222-61-5

Ethyl 3-aminopent-2-enoate

Formula: C₇H₁₃NO₂

Purity: 95%

Molecular weight: 143.18

Ref: IN-DG00981700

Ethyl 3-aminopent-2-enoate

CAS: 3222-61-5

Ethyl 3-aminopent-2-enoate is an enantioselective and efficient ligand that is used in asymmetric synthesis. It reacts with a variety of acceptors such as 2-bromo-3-methylpyridine to form the corresponding β-unsaturated ester. The reaction with cuprate leads to the formation of an α,β-unsaturated carbonyl compound. Ethyl 3-aminopent-2-enoate can be used to synthesize crotonates and esters by hydrolysis and alkylation respectively. The crotonate formed can be converted into its corresponding acid or ester using an enolate formed from ethyl malonate.

Formula: C₇H₁₃NO₂

Purity: Min. 95%

Molecular weight: 143.18 g/mol

Ref: 3D-DAA22261