CymitQuimica logo

CAS 32229-98-4

:

3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-ol

Description:
3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-ol, with the CAS number 32229-98-4, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered ring containing two nitrogen atoms, and is substituted with a 3-chlorophenyl group, enhancing its pharmacological properties. The presence of a propanol side chain contributes to its potential as a bioactive molecule. Typically, compounds of this nature are investigated for their interactions with neurotransmitter systems, particularly in the context of psychopharmacology, where they may exhibit anxiolytic or antidepressant effects. The hydroxyl group in the propanol moiety can influence solubility and reactivity, making it relevant for various applications in medicinal chemistry. Additionally, the chlorine substituent can affect the compound's lipophilicity and biological activity. Overall, this compound's structural features suggest potential therapeutic applications, warranting further research into its pharmacodynamics and pharmacokinetics.
Formula:C13H19ClN2O
InChI:InChI=1/C13H19ClN2O/c14-12-3-1-4-13(11-12)16-8-6-15(7-9-16)5-2-10-17/h1,3-4,11,17H,2,5-10H2
InChI key:MHOVZUZZHTZBSV-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N1CCN(CCCO)CC1)Cl
Found 7 products.