CAS 322471-05-6

2,4,6-Tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]boroxin

Description:

2,4,6-Tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]boroxin, identified by its CAS number 322471-05-6, is a boron-containing compound characterized by its complex structure featuring multiple ether linkages. This substance typically exhibits properties associated with boron compounds, such as potential applications in materials science and organic synthesis. The presence of methoxyethoxy groups suggests that it may possess good solubility in organic solvents and could exhibit interesting reactivity due to the boron atom's ability to form coordination complexes. Additionally, the ether functionalities may contribute to its stability and influence its interaction with other chemical species. The compound's unique structure may also impart specific physical properties, such as viscosity and thermal stability, making it suitable for various applications, including as a precursor in the synthesis of advanced materials or as a reagent in organic chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₂₁H₄₅B₃O₁₅

InChI: InChI=1S/C21H45B3O15/c1-25-4-7-28-10-13-31-16-19-34-22-37-23(35-20-17-32-14-11-29-8-5-26-2)39-24(38-22)36-21-18-33-15-12-30-9-6-27-3/h4-21H2,1-3H3

InChI key: InChIKey=XHSSYJIHEHAECQ-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOC)B1OB(OCCOCCOCCOC)OB(OCCOCCOCCOC)O1

Synonyms:

• Boroxin, tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-
• Boroxin, 2,4,6-tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-
• 2,4,6-Tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]boroxin

Boroxin, tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-

CAS: 322471-05-6

Formula: C₂₁H₄₅B₃O₁₅

Molecular weight: 570.0060

Ref: IN-DA01G9F8