CAS 32253-71-7

Butanoic acid, 3-[(methoxycarbonyl)amino]-2,2,3-trimethyl-

Description:

Butanoic acid, 3-[(methoxycarbonyl)amino]-2,2,3-trimethyl- is an organic compound characterized by its carboxylic acid functional group and an amine substituent. The presence of the butanoic acid moiety indicates that it has a four-carbon backbone with a carboxylic acid (-COOH) group, which contributes to its acidic properties. The methoxycarbonyl group (-COOCH3) suggests that it has an ester-like structure, enhancing its reactivity and solubility in organic solvents. The trimethyl groups indicate that there are three methyl groups attached to the carbon chain, which can influence the compound's steric hindrance and overall stability. This compound may exhibit moderate polarity due to the presence of both hydrophilic (carboxylic acid and methoxy) and hydrophobic (alkyl chains) components. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. As with many organic compounds, its behavior in chemical reactions will depend on the specific conditions and the presence of other reactants.

Formula: C₉H₁₇NO₄

InChI: InChI=1S/C9H17NO4/c1-8(2,6(11)12)9(3,4)10-7(13)14-5/h1-5H3,(H,10,13)(H,11,12)

InChI key: QTEBFSANEDARCQ-UHFFFAOYSA-N

SMILES: CC(C)(C(=O)O)C(C)(C)NC(=O)OC

Synonyms:

• Butanoic acid, 3-[(methoxycarbonyl)amino]-2,2,3-trimethyl-

3-[(Methoxycarbonyl)amino]-2,2,3-trimethylbutanoic acid

CAS: 32253-71-7

3-[(Methoxycarbonyl)amino]-2,2,3-trimethylbutanoic acid

Formula: C₉H₁₇NO₄

Purity: 95%

Molecular weight: 203.24

Ref: 54-OR1002661