CymitQuimica logo

CAS 32272-18-7

:

2-Propen-1-one, 1-(2-hydroxy-4-methoxyphenyl)-3-(2-methoxyphenyl)-

Description:
2-Propen-1-one, 1-(2-hydroxy-4-methoxyphenyl)-3-(2-methoxyphenyl)-, also known by its CAS number 32272-18-7, is an organic compound characterized by its structure, which features a propenone backbone substituted with two aromatic rings. The presence of a hydroxyl group and methoxy groups on the phenyl rings contributes to its potential reactivity and solubility properties. This compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, due to the hydroxyl group. Additionally, the methoxy groups can influence its electronic properties and steric hindrance, affecting its interactions in biological systems. The compound may also participate in various chemical reactions, including electrophilic aromatic substitution and Michael addition, due to the presence of the α,β-unsaturated carbonyl system. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-20-13-8-9-14(16(19)11-13)15(18)10-7-12-5-3-4-6-17(12)21-2/h3-11,19H,1-2H3/b10-7+
InChI key:YSOOAJSZRVJKCW-JXMROGBWSA-N
SMILES:COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=CC=C2OC)O
Synonyms:
  • 2-Propen-1-one, 1-(2-hydroxy-4-methoxyphenyl)-3-(2-methoxyphenyl)-
  • 2'-Hydroxy-2,4'-dimethoxychalcone
Found 1 products.