CAS 322727-85-5

Lithium tetra(8-hydroxyquinolinato)boron

Description:

Lithium tetra(8-hydroxyquinolinato)boron, commonly referred to as LiBQ, is an organometallic compound characterized by its coordination of lithium with a boron atom and four 8-hydroxyquinoline ligands. This compound exhibits unique photophysical properties, making it of interest in various applications, particularly in organic light-emitting diodes (OLEDs) and as a potential phosphorescent material. The presence of the 8-hydroxyquinoline moiety contributes to its ability to form stable chelate complexes, enhancing its solubility and stability in organic solvents. LiBQ typically displays a bright luminescence, which is attributed to the electronic transitions within the ligand framework. Additionally, the compound's structure allows for efficient charge transport, which is crucial for its performance in electronic devices. Its thermal stability and compatibility with other organic materials further enhance its utility in advanced materials science. Overall, lithium tetra(8-hydroxyquinolinato)boron represents a significant compound in the field of organic electronics, combining the properties of lithium, boron, and organic ligands.

Formula: C₃₆H₂₄BN₄O₄Li

InChI: InChI=1S/C36H24BN4O4.Li/c1-9-25-13-5-21-38-33(25)29(17-1)42-37(43-30-18-2-10-26-14-6-22-39-34(26)30,44-31-19-3-11-27-15-7-23-40-35(27)31)45-32-20-4-12-28-16-8-24-41-36(28)32;/h1-24H;/q-1;+1

InChI key: SXZACTBDDJMGBZ-UHFFFAOYSA-N

SMILES: [Li+].[B-](OC1=CC=CC2=C1N=CC=C2)(OC3=CC=CC4=C3N=CC=C4)(OC5=CC=CC6=C5N=CC=C6)OC7=CC=CC8=C7N=CC=C8

Lithiumtetra(8-hydroxyquinolinato)boron

CAS: 322727-85-5

Formula: C₃₆H₂₄BLiN₄O₄

Molecular weight: 594.3521600000001

Ref: IN-DA00CL6C