CAS 32281-36-0
:benzo[1,2-b:4,5-b']bisthiophene-4,8-dione
Description:
Benzo[1,2-b:4,5-b']bisthiophene-4,8-dione is an organic compound characterized by its unique structure, which consists of a fused thiophene system with two carbonyl (dione) groups. This compound exhibits a planar configuration, contributing to its potential for strong π-π stacking interactions, which is significant in materials science, particularly in organic electronics and photovoltaic applications. The presence of the dione functional groups imparts reactivity, allowing for further chemical modifications. Additionally, the compound's electronic properties are influenced by the conjugated system, which can lead to interesting optical characteristics, such as light absorption and emission. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, benzo[1,2-b:4,5-b']bisthiophene-4,8-dione is of interest in research fields exploring organic semiconductors, dyes, and potential applications in organic light-emitting diodes (OLEDs) and organic solar cells.
Formula:C10H4O2S2
InChI:InChI=1/C10H4O2S2/c11-7-5-1-3-13-9(5)8(12)6-2-4-14-10(6)7/h1-4H
SMILES:c1csc2c1C(=O)c1c(ccs1)C2=O
Synonyms:- Benzo[1,2-B:4,5-B']Dithiophene-4,8-Dione
- K0140
- 4,8-Dihydrobenzo[1,2-b:4,5-b']dithiophen-4,8-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzo[1,2-b:4,5-b']dithiophene-4,8-dione
CAS:Formula:C10H4O2S2Purity:>98.0%(GC)Color and Shape:White to Amber to Dark green powder to crystalMolecular weight:220.26Benzo[1,2-b:4,5-b′]dithiophene-4,8-dione
CAS:Formula:C10H4O2S2Purity:97%Color and Shape:SolidMolecular weight:220.2676Benzo[1,2-b;4,5-b']dithiophene-4,8-dione
CAS:Benzo[1,2-b;4,5-b']dithiophene-4,8-dioneFormula:C10H4O2S2Purity:98%Color and Shape:SolidMolecular weight:220.26756Benzo[1,2-b:4,5-b']dithiophene-4,8-dione
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:220.25999450683594Benzo[1,2-b:4,5-b']dithiophene-4,8-dione
CAS:Benzo[1,2-b:4,5-b']dithiophene-4,8-dione is a heterocyclic compound that has been studied for its potential use in electronic devices. The molecule is composed of two aromatic rings and one heterocyclic ring. It is an important building block in the synthesis of many five-membered heterocycles such as benzothiophene and benzofuran. Benzo[1,2-b:4,5-b']dithiophene-4,8-dione can be used as a photoactive material for solar cells due to its ability to absorb light from the visible spectrum and emit it in the near infrared region.
Formula:C10H4O2S2Purity:Min. 95%Color and Shape:White PowderMolecular weight:220.27 g/mol




