CymitQuimica logo

CAS 323-79-5

:

2,2'-{[3-(trifluoromethyl)phenyl]imino}diethanol

Description:
2,2'-{[3-(trifluoromethyl)phenyl]imino}diethanol, identified by its CAS number 323-79-5, is an organic compound characterized by the presence of a trifluoromethyl group attached to a phenyl ring, which contributes to its unique chemical properties. This compound features an imine functional group, linking two diethanol moieties, which enhances its potential for hydrogen bonding and solubility in polar solvents. The trifluoromethyl group is known for its electron-withdrawing effects, which can influence the reactivity and stability of the compound. Typically, such compounds exhibit moderate to high polarity, making them suitable for various applications in organic synthesis and as intermediates in the production of pharmaceuticals or agrochemicals. Additionally, the presence of hydroxyl groups in the diethanol structure may impart some degree of hydrophilicity, allowing for interactions with biological systems. Overall, the combination of these functional groups makes 2,2'-{[3-(trifluoromethyl)phenyl]imino}diethanol a compound of interest in both research and industrial contexts.
Formula:C11H14F3NO2
InChI:InChI=1/C11H14F3NO2/c12-11(13,14)9-2-1-3-10(8-9)15(4-6-16)5-7-17/h1-3,8,16-17H,4-7H2
InChI key:CSXRYPPKUCHPDW-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N(CCO)CCO)C(F)(F)F
Found 2 products.