CAS 32303-82-5

Z-Ala-His-OMe

Description:

Z-Ala-His-OMe, also known as Z-Ala-Histidine methyl ester, is a peptide derivative characterized by the presence of a Z (benzyloxycarbonyl) protecting group on the amino acid alanine (Ala) and a histidine (His) residue with a methyl ester modification. This compound is typically used in peptide synthesis and research due to its ability to protect amino groups during chemical reactions. The Z group enhances the stability of the peptide during synthesis and can be removed under specific conditions to yield the free amino acid. The methyl ester functionality contributes to the compound's solubility and reactivity, making it useful in various biochemical applications. Z-Ala-His-OMe may exhibit biological activity, particularly in studies related to peptide hormones or neurotransmitters, and can serve as a building block for more complex peptides. Its CAS number, 32303-82-5, allows for easy identification and procurement in chemical databases and suppliers.

Formula: C₁₈H₂₂N₄O₅

InChI: InChI=1S/C18H22N4O5/c1-12(21-18(25)27-10-13-6-4-3-5-7-13)16(23)22-15(17(24)26-2)8-14-9-19-11-20-14/h3-7,9,11-12,15H,8,10H2,1-2H3,(H,19,20)(H,21,25)(H,22,23)/t12-,15-/m0/s1

InChI key: FPMLCYUEXWDCDX-WFASDCNBSA-N

SMILES: C[C@@H](C(=O)N[C@@H](CC1=CN=CN1)C(=O)OC)NC(=O)OCC2=CC=CC=C2

Z-Ala-His-OMe

CAS: 32303-82-5

Formula: C₁₈H₂₂N₄O₅

Purity: 99.0%

Molecular weight: 374.397

Ref: 10-F493078