CymitQuimica logo

CAS 3232-37-9

:

Salicylidene Benzoylhydrazone

Description:
Salicylidene benzoylhydrazone is an organic compound characterized by its hydrazone functional group, formed from the condensation of salicylaldehyde and benzoylhydrazine. This compound typically appears as a crystalline solid and is known for its chelating properties, allowing it to form stable complexes with various metal ions. It exhibits a range of biological activities, including potential antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The compound is generally soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. Its structure features both aromatic rings and a hydrazone linkage, contributing to its stability and reactivity. Salicylidene benzoylhydrazone can also undergo tautomerization, which may influence its chemical behavior in different environments. Overall, this compound serves as a valuable ligand in coordination chemistry and has potential applications in various fields, including pharmaceuticals and materials science.
Formula:C14H12N2O2
InChI:InChI=1/C14H12N2O2/c17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11/h1-10,17H,(H,16,18)/b15-10+
InChI key:WKIWEDKDZPIULI-XNTDXEJSSA-N
SMILES:C1=CC=C(C=C1)C(=O)N/N=C/C2=CC=CC=C2O
Synonyms:
  • Salicylaldehyde benzoyl hydrazone
  • Sab hydrazone
  • Benzoic acid, ((2-hydroxyphenyl)methylene)hydrazide
  • N'-[(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzohydrazide
  • N'-[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzohydrazide
  • N'-[(E)-(2-hydroxyphenyl)methylidene]benzohydrazide
Found 3 products.