CymitQuimica logo

CAS 32327-46-1

:

5-Methoxy-1-naphthalenesulfonamide

Description:
5-Methoxy-1-naphthalenesulfonamide is an organic compound characterized by its naphthalene backbone, which is substituted with a methoxy group and a sulfonamide functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group enhances its lipophilicity, while the sulfonamide group can participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its sulfonamide moiety is known for its role in various therapeutic agents, including antibiotics and diuretics. The compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 5-Methoxy-1-naphthalenesulfonamide is a versatile compound with potential applications in research and drug development, warranting further investigation into its properties and effects.
Formula:C11H11NO3S
InChI:InChI=1S/C11H11NO3S/c1-15-10-6-2-5-9-8(10)4-3-7-11(9)16(12,13)14/h2-7H,1H3,(H2,12,13,14)
InChI key:YVXIWLGEICSHPQ-UHFFFAOYSA-N
SMILES:COC1=CC=CC2=C1C=CC=C2S(=O)(=O)N
Found 5 products.