CymitQuimica logo

CAS 32327-47-2

:

5-Amino-1-naphthalenesulfonamide

Description:
5-Amino-1-naphthalenesulfonamide is an organic compound characterized by the presence of an amino group and a sulfonamide functional group attached to a naphthalene ring system. This compound typically appears as a solid, often in a crystalline form, and is soluble in polar solvents such as water and alcohols due to the sulfonamide group, which enhances its hydrophilicity. It is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various drugs and as a reagent in biochemical assays. The presence of the amino group allows for further chemical modifications, making it versatile in organic synthesis. Additionally, 5-Amino-1-naphthalenesulfonamide may exhibit biological activity, including antimicrobial properties, which can be explored in medicinal chemistry. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, this compound is significant in both industrial and research contexts due to its functional groups and structural characteristics.
Formula:C10H10N2O2S
InChI:InChI=1S/C10H10N2O2S/c11-9-5-1-4-8-7(9)3-2-6-10(8)15(12,13)14/h1-6H,11H2,(H2,12,13,14)
InChI key:InChIKey=OSLAXMFJCQKHFS-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C2=C(C(N)=CC=C2)C=CC1
Synonyms:
  • 1-Naphthalenesulfonamide, 5-amino-
  • 1-Aminonaphthalene-5-sulfonamide
  • 5-Amino-1-naphthalenesulfonamide
  • 5-Aminonaphthalene-1-sulfonamide
Found 1 products.