CymitQuimica logo

CAS 32327-68-7

:

1-(2-chloroethyl)-4-methylbenzene

Description:
1-(2-Chloroethyl)-4-methylbenzene, also known as p-chloroethyl toluene, is an organic compound characterized by a benzene ring substituted with a methyl group and a chloroethyl group. Its molecular structure features a chlorine atom attached to a two-carbon ethyl chain, which is further connected to the para position of the methyl-substituted benzene. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is moderately soluble in organic solvents but has limited solubility in water. The presence of the chloroethyl group suggests that it may exhibit reactivity typical of alkyl halides, making it a potential candidate for nucleophilic substitution reactions. Additionally, due to the chlorine atom, it may also participate in electrophilic aromatic substitution reactions. Safety considerations are important, as it may be harmful if inhaled or ingested, and appropriate handling procedures should be followed. Overall, 1-(2-chloroethyl)-4-methylbenzene is of interest in various chemical syntheses and applications in organic chemistry.
Formula:C9H11Cl
InChI:InChI=1/C9H11Cl/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6-7H2,1H3
InChI key:TWIWWNQQAVOIQJ-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)CCCl
Found 1 products.