CymitQuimica logo

CAS 32337-85-2

:

1H-Inden-5-ol, 6-bromo-2,3-dihydro-

Description:
1H-Inden-5-ol, 6-bromo-2,3-dihydro- (CAS 32337-85-2) is an organic compound characterized by its bicyclic structure, which includes an indene framework with a hydroxyl group (-OH) and a bromine atom substituent. The presence of the hydroxyl group indicates that it is an alcohol, which can participate in hydrogen bonding, potentially affecting its solubility and reactivity. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests it may exhibit interesting chemical properties, including potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the dihydro form indicates that it has two additional hydrogen atoms compared to its fully unsaturated counterpart, which may influence its stability and reactivity. Overall, 1H-Inden-5-ol, 6-bromo-2,3-dihydro- is a compound of interest in the field of organic chemistry.
Formula:C9H9BrO
InChI:InChI=1S/C9H9BrO/c10-8-4-6-2-1-3-7(6)5-9(8)11/h4-5,11H,1-3H2
InChI key:WXNQTFRWOCSCPY-UHFFFAOYSA-N
SMILES:C1CC2=CC(=C(C=C2C1)Br)O
Found 4 products.