CymitQuimica logo

CAS 32337-95-4

:

2-Bromo-1-iodo-3-nitrobenzene

Description:
2-Bromo-1-iodo-3-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, an iodine atom, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the meta position relative to the bromine and iodine substituents, which can influence its reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit a yellow to brown color. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both halogens (bromine and iodine) can enhance its electrophilic reactivity, making it a useful intermediate in various chemical reactions. Additionally, the nitro group can serve as a strong electron-withdrawing group, affecting the compound's overall electronic properties and reactivity. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards.
Formula:C6H3BrINO2
InChI:InChI=1S/C6H3BrINO2/c7-6-4(8)2-1-3-5(6)9(10)11/h1-3H
InChI key:InChIKey=NKFATHXREYJOQX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Br)C(I)=CC=C1
Synonyms:
  • 2-Bromo-3-iodo-1-nitrobenzene
  • 2-Bromo-1-iodo-3-nitrobenzene
  • Benzene, 2-bromo-1-iodo-3-nitro-
  • 2-Bromo-3-iodonitrobenzene
Found 4 products.