CymitQuimica logo

CAS 32338-22-0

:

1H-Isoindole-1,3(2H)-dione, 2-(3-aminophenyl)-

Description:
1H-Isoindole-1,3(2H)-dione, 2-(3-aminophenyl)-, also known by its CAS number 32338-22-0, is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. This compound contains a dione functional group, indicating the presence of two carbonyl (C=O) groups, and an amino group (-NH2) attached to a phenyl ring, specifically at the 3-position. The presence of these functional groups contributes to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as fluorescence or the ability to participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. The compound may also have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific properties such as solubility, melting point, and stability would require empirical data for precise characterization.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c15-9-4-3-5-10(8-9)16-13(17)11-6-1-2-7-12(11)14(16)18/h1-8H,15H2
InChI key:OOPLRJVJUNAQIG-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC(=C3)N
Found 1 products.