CAS 32362-88-2

1,2-Dihydro-5-(3-pyridinyl)-3H-1,2,4-triazole-3-thione

Description:

1,2-Dihydro-5-(3-pyridinyl)-3H-1,2,4-triazole-3-thione is a heterocyclic compound characterized by its triazole ring structure, which contains both nitrogen and sulfur atoms. This compound features a pyridine substituent, contributing to its potential biological activity and solubility properties. The presence of the thione functional group (–C=S) indicates that it may exhibit unique reactivity and interactions, particularly in coordination chemistry and biological systems. The compound is typically a solid at room temperature and may have moderate to high polarity due to the presence of nitrogen and sulfur atoms, influencing its solubility in various solvents. It is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a ligand in coordination complexes. The specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on the purity and form of the compound. As with many triazole derivatives, it may also exhibit antifungal or antimicrobial properties, making it of interest in medicinal chemistry.

Formula: C₇H₆N₄S

InChI: InChI=1/C7H6N4S/c12-7-9-6(10-11-7)5-2-1-3-8-4-5/h1-4H,(H2,9,10,11,12)

InChI key: GAYWCADKXYCKCG-UHFFFAOYSA-N

SMILES: c1cc(cnc1)c1nc(n[nH]1)S

Synonyms:

• 5-(pyridin-3-yl)-4H-1,2,4-triazole-3-thiol

1,2-Dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione

CAS: 32362-88-2

1,2-Dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione

Formula: C₇H₆N₄S

Purity: ≥97%

Molecular weight: 178.21

Ref: 54-OR1141971

1,2-Dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione

CAS: 32362-88-2

Formula: C₇H₆N₄S

Purity: 97%

Molecular weight: 178.2143

Ref: IN-DA003M4T