CymitQuimica logo

CAS 32368-14-2

:

1,3-Dioxan-2-one, 5,5-dimethyl-4-(1-methylethyl)-

Description:
1,3-Dioxan-2-one, 5,5-dimethyl-4-(1-methylethyl)-, with the CAS number 32368-14-2, is a cyclic organic compound characterized by its dioxane ring structure, which includes two oxygen atoms and a carbonyl group. This compound features a dimethyl substitution at the 5-position and an isopropyl group at the 4-position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the dioxanone moiety suggests potential reactivity in various chemical reactions, including ring-opening and polymerization processes. Its structure may impart specific physical properties such as solubility in organic solvents and moderate stability under standard conditions. Additionally, compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. However, detailed safety and handling information should be consulted, as with all chemical substances, to ensure proper usage and risk management.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-6(2)7-9(3,4)5-11-8(10)12-7/h6-7H,5H2,1-4H3
InChI key:UHKHSJAFYFTMSC-UHFFFAOYSA-N
SMILES:CC(C)C1C(COC(=O)O1)(C)C
Found 3 products.