CAS 3237-31-8

N-cyclohexylbenzenesulfonamide

Description:

N-cyclohexylbenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a cyclohexyl group and a benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is known for its solubility in organic solvents, while being less soluble in water. The sulfonamide group contributes to its potential as a pharmaceutical intermediate, as sulfonamides are known for their antibacterial properties. N-cyclohexylbenzenesulfonamide may also exhibit moderate to high melting and boiling points due to the presence of strong intermolecular forces, such as hydrogen bonding and dipole-dipole interactions. Its chemical structure allows for various applications in organic synthesis and medicinal chemistry. Safety data indicates that, like many sulfonamides, it should be handled with care, as it may cause skin or respiratory irritation. Overall, N-cyclohexylbenzenesulfonamide is a versatile compound with significant relevance in chemical research and development.

Formula: C₁₂H₁₇NO₂S

InChI: InChI=1/C12H17NO2S/c14-16(15,12-9-5-2-6-10-12)13-11-7-3-1-4-8-11/h2,5-6,9-11,13H,1,3-4,7-8H2

InChI key: YRJGYGPIEHIQPP-UHFFFAOYSA-N

SMILES: C1CCC(CC1)NS(=O)(=O)c1ccccc1

Synonyms:

• benzenesulfonamide, N-cyclohexyl-

N-Cyclohexylbenzenesulfonamide

CAS: 3237-31-8

N-Cyclohexylbenzenesulfonamide

Formula: C₁₂H₁₇NO₂S

Purity: 95%

Molecular weight: 239.34

Ref: 54-OR1160326