CAS 3238-95-7

1,1'-(ethane-1,2-diyldisulfanediyl)bis(4-methylbenzene)

Description:

1,1'-(ethane-1,2-diyldisulfanediyl)bis(4-methylbenzene), also known by its CAS number 3238-95-7, is an organic compound characterized by its unique structure that includes a central ethane-1,2-diyldisulfanediyl group flanked by two 4-methylbenzene (p-xylene) moieties. This compound features sulfur atoms, indicating the presence of disulfide linkages, which can impart specific chemical reactivity and stability. The presence of the methyl groups on the benzene rings contributes to its hydrophobic character and can influence its solubility in organic solvents. Additionally, the compound may exhibit interesting properties such as potential antioxidant activity due to the disulfide bonds. Its molecular structure suggests that it could participate in various chemical reactions, including oxidation and reduction processes. Overall, this compound's unique arrangement of functional groups and aromatic rings makes it a subject of interest in organic chemistry and materials science.

Formula: C₁₆H₁₈S₂

InChI: InChI=1/C16H18S2/c1-13-3-7-15(8-4-13)17-11-12-18-16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3

InChI key: XBUYYHDXYKTSGT-UHFFFAOYSA-N

SMILES: Cc1ccc(cc1)SCCSc1ccc(C)cc1

1,2-Bis(p-tolylthio)ethane

CAS: 3238-95-7

Formula: C₁₆H₁₈S₂

Purity: 97%

Molecular weight: 274.44

Ref: 10-F095015