CAS 32380-70-4

2-(2-Hydroxypropoxy)-1H-isoindole-1,3(2H)-dione

Description:

2-(2-Hydroxypropoxy)-1H-isoindole-1,3(2H)-dione, also known by its CAS number 32380-70-4, is a chemical compound characterized by its isoindole structure, which features a bicyclic system comprising a five-membered ring fused to a six-membered ring. This compound contains a hydroxypropoxy group, which contributes to its solubility and reactivity. It typically exhibits properties such as moderate polarity due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The isoindole moiety is known for its potential biological activity, making this compound of interest in medicinal chemistry. Its applications may extend to pharmaceuticals, where it could serve as a precursor or an intermediate in the synthesis of more complex molecules. The stability and reactivity of this compound can be influenced by factors such as pH and temperature, and it may undergo various chemical reactions, including esterification and nucleophilic substitutions. Overall, 2-(2-Hydroxypropoxy)-1H-isoindole-1,3(2H)-dione represents a versatile structure with potential applications in various chemical and biological fields.

Formula: C₁₁H₁₁NO₄

InChI: InChI=1S/C11H11NO4/c1-7(13)6-16-12-10(14)8-4-2-3-5-9(8)11(12)15/h2-5,7,13H,6H2,1H3

InChI key: InChIKey=YRSCUJZERMIHAJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1OCC(C)O)=CC=CC2

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-(2-hydroxypropoxy)-
• N-[O-(2-Hydroxypropyl)]hydroxyphthalimide
• Phthalimide, N-(2-hydroxypropoxy)-
• 2-(2-Hydroxypropoxy)isoindole-1,3-dione
• 2-(2-Hydroxypropoxy)-1H-isoindole-1,3(2H)-dione

2-(2-Hydroxypropoxy)isoindoline-1,3-dione

CAS: 32380-70-4

Formula: C₁₁H₁₁NO₄

Molecular weight: 221.2093

Ref: IN-DA00I64S