CAS 32383-76-9
:Medicarpin
Description:
Medicarpin is a naturally occurring flavonoid, specifically a type of isoflavonoid, primarily found in various plants, including those in the legume family. It is characterized by its chemical structure, which includes a chromen-4-one backbone, contributing to its biological activity. Medicarpin exhibits a range of pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in medicinal chemistry and pharmacology. Its ability to interact with various biological pathways suggests potential therapeutic applications. The compound is also noted for its role in plant defense mechanisms, providing protection against pathogens. Medicarpin's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its extraction and application in research. As a compound with a CAS number of 32383-76-9, it is recognized in chemical databases, facilitating its identification and study in various scientific contexts.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m0/s1
InChI key:InChIKey=NSRJSISNDPOJOP-BBRMVZONSA-N
SMILES:OC=1C=C2C([C@]3([C@](C=4C(O3)=CC(OC)=CC4)(CO2)[H])[H])=CC1
Synonyms:- (-)-3-Hydroxy-9-methoxypterocarpan
- (-)-Medicarpin
- (6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol
- (6aR-cis)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol
- 32383-76-9
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, (6aR,11aR)-
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, (6aR-cis)-
- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, cis-(-)-
- Demethylhomopterocarpin
- NSC 350085
- l-3-Hydroxy-9-methoxypterocarpan
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-,(6aR,11aR)-
CAS:Formula:C16H14O4Purity:98%Color and Shape:SolidMolecular weight:270.2800Medicarpin
CAS:Medicarpin, an ER agonist, stimulates osteoblasts, enhances peak bone mass, has no uterine effects, and is orally bioavailable.Formula:C16H14O4Purity:99.32% - 99.86%Color and Shape:SolidMolecular weight:270.28Ref: TM-TN1918
1mg109.00€1mL*10mM (DMSO)235.00€5mg260.00€10mg385.00€25mg628.00€50mg872.00€100mg1,153.00€200mg1,584.00€(-)-Medicarpin
CAS:(-)-Medicarpin is a phytoalexin, which is a type of natural antimicrobial compound. It is derived from leguminous plants, including certain species of Medicago, where it plays a crucial role in plant defense mechanisms. This compound is biosynthesized in response to pathogenic attack, particularly fungal infections, thereby enhancing the plant's resistance to such threats.
Formula:C16H14O4Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:270.28 g/mol







