CymitQuimica logo

CAS 32384-98-8

:

5,12-Naphthacenedione,8-acetyl-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8R)-

Description:
5,12-Naphthacenedione, 8-acetyl-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8R)-, with the CAS number 32384-98-8, is a complex organic compound characterized by its polycyclic structure, which includes a naphthacene core. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in various solvents. The presence of an acetyl group and a methoxy group further modifies its chemical properties, influencing its polarity and interaction with biological systems. The stereochemistry indicated by the (8R) designation suggests a specific three-dimensional arrangement of atoms, which can significantly affect the compound's biological activity and pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile scaffold for synthetic chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C21H18O7
InChI:InChI=1S/C21H20O6/c1-3-21(26)8-7-10-12(9-21)19(24)15-16(17(10)22)20(25)14-11(18(15)23)5-4-6-13(14)27-2/h4-6,22,24,26H,3,7-9H2,1-2H3/t21-/m1/s1
InChI key:FGHXRNYXQQVEDV-OAQYLSRUSA-N
SMILES:CC[C@]1(CCC2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4OC)O)O
Synonyms:
  • 7-Deoxydaunorubicin aglycone
  • 7-Deoxydaunomycinone
  • Deoxydaunorubicin aglycone
  • (-)-7-Deoxydaunomycinone
  • 5,12-Naphthacenedione,8-acetyl-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (R)- (8CI)
Found 1 products.