
CAS 32385-06-1
:Methyl-a-L-Daunosaminide, Hydrochloride (~15% b-Anomer)
Description:
Methyl-a-L-Daunosaminide hydrochloride, with the CAS number 32385-06-1, is a chemical compound that belongs to the class of amino sugars. It is characterized by the presence of a methyl group and an amino group, which contribute to its biological activity. The compound is typically found in a hydrochloride salt form, enhancing its solubility in water and making it suitable for various applications in biochemical research. The notation indicating that it contains approximately 15% of the β-anomer suggests that it exists in two anomeric forms, with the α-anomer being predominant. This structural feature can influence its reactivity and interaction with biological molecules, such as enzymes and receptors. Methyl-a-L-Daunosaminide is of interest in the study of glycosylation processes and may have implications in drug development, particularly in the context of antibiotic and anticancer research. Its properties, including stability and solubility, make it a valuable compound for synthetic and analytical chemistry applications.
Formula:C7H16ClNO3
InChI:InChI=1S/C7H15NO3.ClH/c1-4-7(9)5(8)3-6(10-2)11-4;/h4-7,9H,3,8H2,1-2H3;1H/t4-,5-,6+,7+;/m0./s1
InChI key:JVYGBUAXDCLPMP-AOAPYHFMSA-N
SMILES:C[C@H]1[C@H]([C@H](C[C@@H](O1)OC)N)O.Cl
Synonyms:- Methyl L-Daunosamine hydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
α-Methyl daunosaminide hydrochloride
CAS:α-Methyl daunosaminide hydrochlorideFormula:C7H16ClNO3Purity:95%Molecular weight:197.66Methyl α-L-daunosamide hydrochloride
CAS:Methyl α-L-daunosamide hydrochloride is a drug that inhibits the production of DNA. It is used to treat infectious diseases such as malaria, in which it can inhibit the growth of the parasite by preventing DNA replication and transcription. The methyl α-L-daunosamide hydrochloride molecule is a polymerase chain inhibitor that binds to the enzyme adriamycin synthetase, which catalyzes the conversion of daunosamine into adriamycin. This binding prevents the formation of stable complexes with the target enzymes and blocks their activity, leading to inhibition of DNA synthesis and transcription. Methyl α-L-daunosamide hydrochloride has been shown to inhibit glycan biosynthesis in rat liver microsomes and does not have significant interactions with other drugs or with glycan in human serum.Formula:C7H15NO3•HClPurity:Min. 85 Area-%Color and Shape:PowderMolecular weight:197.66 g/molMethyl Alpha-L-Daunosamine Hydrochloride (Alpha:Beta approx. 85:15)
CAS:Controlled ProductApplications Methyl α-L-Daunosamine is used in the synthesis of (L)-Daunosamine and related amino sugars.
References Di Marco, A., et al.: Tumori, 49, 203 (1963), Nagumo, S., et al.: Chem. Pharm. Bull., 43, 171 (1995),Formula:C7H15NO3·ClHColor and Shape:NeatMolecular weight:197.66α-Methyl daunosaminide hydrochloride
CAS:Formula:C7H16ClNO3Purity:95%Color and Shape:SolidMolecular weight:197.6598Ref: IN-DA00C9MB
Discontinued product





