CymitQuimica logo

CAS 32385-06-1

:

Methyl-a-L-Daunosaminide, Hydrochloride (~15% b-Anomer)

Description:
Methyl-a-L-Daunosaminide hydrochloride, with the CAS number 32385-06-1, is a chemical compound that belongs to the class of amino sugars. It is characterized by the presence of a methyl group and an amino group, which contribute to its biological activity. The compound is typically found in a hydrochloride salt form, enhancing its solubility in water and making it suitable for various applications in biochemical research. The notation indicating that it contains approximately 15% of the β-anomer suggests that it exists in two anomeric forms, with the α-anomer being predominant. This structural feature can influence its reactivity and interaction with biological molecules, such as enzymes and receptors. Methyl-a-L-Daunosaminide is of interest in the study of glycosylation processes and may have implications in drug development, particularly in the context of antibiotic and anticancer research. Its properties, including stability and solubility, make it a valuable compound for synthetic and analytical chemistry applications.
Formula:C7H16ClNO3
InChI:InChI=1S/C7H15NO3.ClH/c1-4-7(9)5(8)3-6(10-2)11-4;/h4-7,9H,3,8H2,1-2H3;1H/t4-,5-,6+,7+;/m0./s1
InChI key:JVYGBUAXDCLPMP-AOAPYHFMSA-N
SMILES:C[C@H]1[C@H]([C@H](C[C@@H](O1)OC)N)O.Cl
Synonyms:
  • Methyl L-Daunosamine hydrochloride
Found 5 products.