CymitQuimica logo

CAS 32386-87-1

:

2,3-dihydro-1H-benzo[de]isoquinoline hydrochloride (1:1)

Description:
2,3-Dihydro-1H-benzo[de]isoquinoline hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a fused isoquinoline system. This substance typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility compared to the free base. The compound is of interest in medicinal chemistry due to its potential biological activities, including effects on the central nervous system. Its molecular structure features a nitrogen atom within the ring system, contributing to its reactivity and interaction with biological targets. As with many organic compounds, handling should be done with care, following appropriate safety protocols, as it may exhibit toxicity or other hazardous properties. Overall, 2,3-dihydro-1H-benzo[de]isoquinoline hydrochloride serves as a valuable compound in research and development within the pharmaceutical field.
Formula:C12H12ClN
InChI:InChI=1/C12H11N.ClH/c1-3-9-4-2-6-11-8-13-7-10(5-1)12(9)11;/h1-6,13H,7-8H2;1H
InChI key:RHJYITSOKPRKHB-UHFFFAOYSA-N
SMILES:c1cc2cccc3CNCc(c1)c23.Cl
Found 3 products.