CymitQuimica logo

CAS 32387-96-5

:

2,3-diphenylquinoxaline-6-carboxylic acid

Description:
2,3-Diphenylquinoxaline-6-carboxylic acid is an organic compound characterized by its quinoxaline core, which features two phenyl groups and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents, while the phenyl groups enhance its stability and may influence its electronic properties. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for studies in materials science and photochemistry. Its structural features allow for various chemical modifications, which can lead to derivatives with tailored properties for specific applications. As with many quinoxaline derivatives, it may also display biological activity, warranting further investigation into its potential therapeutic uses.
Formula:C21H14N2O2
InChI:InChI=1/C21H14N2O2/c24-21(25)16-11-12-17-18(13-16)23-20(15-9-5-2-6-10-15)19(22-17)14-7-3-1-4-8-14/h1-13H,(H,24,25)
InChI key:LFWGZXMTCUOPFI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c(c2ccccc2)nc2cc(ccc2n1)C(=O)O
Synonyms:
  • 6-Quinoxalinecarboxylic acid, 2,3-diphenyl-
Found 4 products.