CAS 32391-97-2
:4-(methylsulfanyl)butanoic acid
Description:
4-(Methylsulfanyl)butanoic acid, also known by its IUPAC name, is an organic compound characterized by a butanoic acid backbone with a methylsulfanyl group attached to the fourth carbon. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, and a methylthio group (-S-CH3), which can influence its reactivity and solubility. The presence of the sulfur atom in the methylsulfanyl group can enhance the compound's nucleophilicity and may affect its interactions in biological systems. Typically, such compounds exhibit moderate polarity due to the carboxylic acid and thioether functionalities, allowing for potential solubility in polar solvents. The compound may also participate in various chemical reactions, including esterification and amidation, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and stability.
Formula:C5H10O2S
InChI:InChI=1/C5H10O2S/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H,6,7)
SMILES:CSCCCC(=O)O
Synonyms:- Butanoic Acid, 4-(Methylthio)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(Methylsulphanyl)butanoic acid
CAS:4-(Methylsulphanyl)butanoic acidPurity:≥95%Molecular weight:134.20g/mol4-(Methylsulfanyl)butanoic acid
CAS:4-(Methylsulfanyl)butanoic acid is an organic solvent that is used in the production of butyric acid and butyronitrile. It is also a reaction product of inorganic acids, such as sulfuric acid, hydrogen sulfate, and nitric acid. 4-(Methylsulfanyl)butanoic acid has a crystalline structure and optical properties that are similar to those of acetic acid. This compound is expressed in plasmids and can be used as an amide or metal chelate. The enzymatic methods of 4-(methylsulfanyl)butanoic acid are supplementing with hydrogen sulfate or recycled by adding an acid catalyst.Formula:C5H10O2SPurity:Min. 95%Molecular weight:134.2 g/mol

