CymitQuimica logo

CAS 32391-97-2

:

4-(methylsulfanyl)butanoic acid

Description:
4-(Methylsulfanyl)butanoic acid, also known by its IUPAC name, is an organic compound characterized by a butanoic acid backbone with a methylsulfanyl group attached to the fourth carbon. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, and a methylthio group (-S-CH3), which can influence its reactivity and solubility. The presence of the sulfur atom in the methylsulfanyl group can enhance the compound's nucleophilicity and may affect its interactions in biological systems. Typically, such compounds exhibit moderate polarity due to the carboxylic acid and thioether functionalities, allowing for potential solubility in polar solvents. The compound may also participate in various chemical reactions, including esterification and amidation, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and stability.
Formula:C5H10O2S
InChI:InChI=1/C5H10O2S/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H,6,7)
InChI key:VDSUAILXEZKWIZ-UHFFFAOYSA-N
SMILES:CSCCCC(=O)O
Synonyms:
  • Butanoic Acid, 4-(Methylthio)-
Found 4 products.