CymitQuimica logo

CAS 32399-08-9

:

2-Methylaminopyridine-3-carbaldehyde

Description:
2-Methylaminopyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring, which is substituted with a methylamino group and an aldehyde functional group. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. It has a molecular formula that reflects its structure, containing carbon, hydrogen, nitrogen, and oxygen atoms. The presence of the aldehyde group makes it a reactive species, capable of participating in various chemical reactions, such as condensation and nucleophilic addition. The methylamino group contributes to its basicity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. This compound is of interest in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of more complex molecules. Its unique structural features may also impart specific biological activities, making it a subject of research in pharmacology. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-8-7-6(5-10)3-2-4-9-7/h2-5H,1H3,(H,8,9)
InChI key:HLHGWWKGIQXCKA-UHFFFAOYSA-N
SMILES:CNc1c(cccn1)C=O
Synonyms:
  • 2-(Methylamino)nicotinaldehyde
Found 3 products.